C27H30BF3N7O3+ — CID 123357151
7-(2-aminopyrimidin-1-ium-5-yl)-1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 123357151) has the molecular formula C27H30BF3N7O3+ and a molecular weight of 568.39 g/mol. Its IUPAC name is 7-(2-aminopyrimidin-1-ium-5-yl)-1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 7-(2-aminopyrimidin-1-ium-5-yl)-1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 123357151 |
| Molecular Formula | C27H30BF3N7O3+ |
| Molecular Weight | 568.39 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 7-(2-aminopyrimidin-1-ium-5-yl)-1-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | CC1(C)OB(c2cc3c(cc2-c2cnc(N)[nH+]c2)[nH]c2c(C(N)=O)cnc(N[C@H](C4CC4)C(F)(F)F)c23)OC1(C)C |
| InChI | InChI=1S/C27H29BF3N7O3/c1-25(2)26(3,4)41-28(40-25)17-7-15-18(8-14(17)13-9-35-24(33)36-10-13)37-20-16(22(32)39)11-34-23(19(15)20)38-21(12-5-6-12)27(29,30)31/h7-12,21,37H,5-6H2,1-4H3,(H2,32,39)(H,34,38)(H2,33,35,36)/p+1/t21-/m1/s1 |
| InChIKey | ZCLFEJROHINRDW-OAQYLSRUSA-O |
| XLogP | 3.33 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|