About 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide
8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 23582762) has the molecular formula C20H25FN4O
and a molecular weight of 356.45 g/mol. Its IUPAC name is 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide.
Molecular Properties
| Compound Name | 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide |
| PubChem CID | 23582762 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | CCCCCCCCNc1ncc(C(N)=O)c2[nH]c3ccc(F)cc3c12 |
| InChI | InChI=1S/C20H25FN4O/c1-2-3-4-5-6-7-10-23-20-17-14-11-13(21)8-9-16(14)25-18(17)15(12-24-20)19(22)26/h8-9,11-12,25H,2-7,10H2,1H3,(H2,22,26)(H,23,24) |
| InChIKey | NYWVHOOSOVUOCH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide?
The IUPAC name of 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide (CID 23582762) is 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide.
What is the SMILES notation for 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide?
The canonical SMILES for 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide is CCCCCCCCNc1ncc(C(N)=O)c2[nH]c3ccc(F)cc3c12.
What is the InChIKey of 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide?
The InChIKey is NYWVHOOSOVUOCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN4O/c1-2-3-4-5-6-7-10-23-20-17-14-11-13(21)8-9-16(14)25-18(17)15(12-24-20)19(22)26/h8-9,11-12,25H,2-7,10H2,1H3,(H2,22,26)(H,23,24).
What are the key properties of 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide?
8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide has a molecular weight of 356.45 g/mol, XLogP of 4.73, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-1-(octylamino)-5H-pyrido[4,3-b]indole-4-carboxamide is sourced from PubChem (CID 23582762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).