C19H23FN4O — CID 23582702
8-fluoro-1-(heptylamino)-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 23582702) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 8-fluoro-1-(heptylamino)-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 8-fluoro-1-(heptylamino)-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 23582702 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 8-fluoro-1-(heptylamino)-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | CCCCCCCNc1ncc(C(N)=O)c2[nH]c3ccc(F)cc3c12 |
| InChI | InChI=1S/C19H23FN4O/c1-2-3-4-5-6-9-22-19-16-13-10-12(20)7-8-15(13)24-17(16)14(11-23-19)18(21)25/h7-8,10-11,24H,2-6,9H2,1H3,(H2,21,25)(H,22,23) |
| InChIKey | CTVKHORDJFNXQQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|