C23H26BF3N4O3 — CID 70842044
1-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide (PubChem CID 70842044) has the molecular formula C23H26BF3N4O3 and a molecular weight of 474.29 g/mol. Its IUPAC name is 1-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide.
| Compound Name | 1-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 70842044 |
| Molecular Formula | C23H26BF3N4O3 |
| Molecular Weight | 474.29 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[(1-cyclopropyl-2,2,2-trifluoroethyl)amino]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-pyrido[4,3-b]indole-4-carboxamide |
| SMILES | CC1(C)OB(c2ccc3c(c2)[nH]c2c(C(N)=O)cnc(NC(C4CC4)C(F)(F)F)c23)OC1(C)C |
| InChI | InChI=1S/C23H26BF3N4O3/c1-21(2)22(3,4)34-24(33-21)12-7-8-13-15(9-12)30-17-14(19(28)32)10-29-20(16(13)17)31-18(11-5-6-11)23(25,26)27/h7-11,18,30H,5-6H2,1-4H3,(H2,28,32)(H,29,31) |
| InChIKey | PBUOXKHHGAFJAP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|