C18H22O3 — CID 23584522
[(1S,3S,4S)-4-ethenyl-2,2-dimethyl-3-phenylmethoxycyclobutyl] prop-2-enoate (PubChem CID 23584522) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(1S,3S,4S)-4-ethenyl-2,2-dimethyl-3-phenylmethoxycyclobutyl] prop-2-enoate.
| Compound Name | [(1S,3S,4S)-4-ethenyl-2,2-dimethyl-3-phenylmethoxycyclobutyl] prop-2-enoate |
|---|---|
| PubChem CID | 23584522 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(1S,3S,4S)-4-ethenyl-2,2-dimethyl-3-phenylmethoxycyclobutyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H]1[C@@H](C=C)[C@H](OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C18H22O3/c1-5-14-16(20-12-13-10-8-7-9-11-13)18(3,4)17(14)21-15(19)6-2/h5-11,14,16-17H,1-2,12H2,3-4H3/t14-,16-,17-/m0/s1 |
| InChIKey | PSWPEELBTQKZGC-XIRDDKMYSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|