C25H19N5O2S — CID 2358865
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N'-(3-oxoinden-1-yl)acetohydrazide (PubChem CID 2358865) has the molecular formula C25H19N5O2S and a molecular weight of 453.53 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N'-(3-oxoinden-1-yl)acetohydrazide.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N'-(3-oxoinden-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 2358865 |
| Molecular Formula | C25H19N5O2S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-N'-(3-oxoinden-1-yl)acetohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)NNC1=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C25H19N5O2S/c31-22-15-21(19-13-7-8-14-20(19)22)26-27-23(32)16-33-25-29-28-24(17-9-3-1-4-10-17)30(25)18-11-5-2-6-12-18/h1-15,26H,16H2,(H,27,32) |
| InChIKey | PGOFVWQVXHVSBC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|