C18H30N2O2S — CID 23591403
1-[2-(5-tert-butyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]-2-(sulfanylmethyl)hexan-1-one (PubChem CID 23591403) has the molecular formula C18H30N2O2S and a molecular weight of 338.52 g/mol. Its IUPAC name is 1-[2-(5-tert-butyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]-2-(sulfanylmethyl)hexan-1-one.
| Compound Name | 1-[2-(5-tert-butyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]-2-(sulfanylmethyl)hexan-1-one |
|---|---|
| PubChem CID | 23591403 |
| Molecular Formula | C18H30N2O2S |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-[2-(5-tert-butyl-1,3-oxazol-2-yl)pyrrolidin-1-yl]-2-(sulfanylmethyl)hexan-1-one |
| SMILES | CCCCC(CS)C(=O)N1CCCC1c1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C18H30N2O2S/c1-5-6-8-13(12-23)17(21)20-10-7-9-14(20)16-19-11-15(22-16)18(2,3)4/h11,13-14,23H,5-10,12H2,1-4H3 |
| InChIKey | XPGDUXNQERDQAT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|