About CID 23616677
CID 23616677 (PubChem CID 23616677) has the molecular formula CH3AsNa2O3+
and a molecular weight of 183.93 g/mol.
Molecular Properties
| Compound Name | CID 23616677 |
| PubChem CID | 23616677 |
| Molecular Formula | CH3AsNa2O3+ |
| Molecular Weight | 183.93 g/mol |
| Exact Mass | 183.91 |
| IUPAC Name | — |
| SMILES | CO[As](=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/CH3AsO3.2Na/c1-5-2(3)4;;/h1H3;;/q-1;2*+1 |
| InChIKey | TYUKDQDDKCBGQX-UHFFFAOYSA-N |
| XLogP | -7.58 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.93 |
| LogP ≤ 5 | -7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23616677 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23616677?
The IUPAC name of CID 23616677 (CID 23616677) is not available.
What is the SMILES notation for CID 23616677?
The canonical SMILES for CID 23616677 is CO[As](=O)[O-].[Na+].[Na+].
What is the InChIKey of CID 23616677?
The InChIKey is TYUKDQDDKCBGQX-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3AsO3.2Na/c1-5-2(3)4;;/h1H3;;/q-1;2*+1.
What are the key properties of CID 23616677?
CID 23616677 has a molecular weight of 183.93 g/mol, XLogP of -7.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23616677 is sourced from PubChem (CID 23616677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).