About sodium;iron(2+);arsorite
sodium;iron(2+);arsorite (PubChem CID 174975059) has the molecular formula AsFeNaO3
and a molecular weight of 201.75 g/mol. Its IUPAC name is sodium;iron(2+);arsorite.
Molecular Properties
| Compound Name | sodium;iron(2+);arsorite |
|---|
| PubChem CID | 174975059 |
|---|
| Molecular Formula | AsFeNaO3 |
|---|
| Molecular Weight | 201.75 g/mol |
|---|
| Exact Mass | 201.83 |
|---|
| IUPAC Name | sodium;iron(2+);arsorite |
|---|
| SMILES | [Fe+2].[Na+].[O-][As]([O-])[O-] |
|---|
| InChI | InChI=1S/AsO3.Fe.Na/c2-1(3)4;;/q-3;+2;+1 |
|---|
| InChIKey | NBJRBYBMFYKRJX-UHFFFAOYSA-N |
|---|
| XLogP | -6.95 |
|---|
| TPSA | 69.18 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 6 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 201.75 |
| LogP ≤ 5 | -6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;iron(2+);arsorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;iron(2+);arsorite?
The IUPAC name of sodium;iron(2+);arsorite (CID 174975059) is sodium;iron(2+);arsorite.
What is the SMILES notation for sodium;iron(2+);arsorite?
The canonical SMILES for sodium;iron(2+);arsorite is [Fe+2].[Na+].[O-][As]([O-])[O-].
What is the InChIKey of sodium;iron(2+);arsorite?
The InChIKey is NBJRBYBMFYKRJX-UHFFFAOYSA-N. The full InChI is InChI=1S/AsO3.Fe.Na/c2-1(3)4;;/q-3;+2;+1.
What are the key properties of sodium;iron(2+);arsorite?
sodium;iron(2+);arsorite has a molecular weight of 201.75 g/mol, XLogP of -6.95, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;iron(2+);arsorite is sourced from PubChem (CID 174975059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).