sodium dihydrogen arsorite

H2AsNaO3 — CID 23665008

IUPACsodium dihydrogen arsorite
SMILES[Na+].[O-][As](O)O
InChIInChI=1S/AsH2O3.Na/c2-1(3)4;/h2-3H;/q-1;+1
InChIKeyOMPOAAVAIXSVJZ-UHFFFAOYSA-N
MW147.93 g/mol
LogP-5.68
Rot. Bonds

About sodium dihydrogen arsorite

sodium dihydrogen arsorite (PubChem CID 23665008) has the molecular formula H2AsNaO3 and a molecular weight of 147.93 g/mol. Its IUPAC name is sodium dihydrogen arsorite.

Molecular Properties

Compound Namesodium dihydrogen arsorite
PubChem CID23665008
Molecular FormulaH2AsNaO3
Molecular Weight147.93 g/mol
Exact Mass147.91
IUPAC Namesodium dihydrogen arsorite
SMILES[Na+].[O-][As](O)O
InChIInChI=1S/AsH2O3.Na/c2-1(3)4;/h2-3H;/q-1;+1
InChIKeyOMPOAAVAIXSVJZ-UHFFFAOYSA-N
XLogP-5.68
TPSA63.52 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.93
LogP ≤ 5-5.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze sodium dihydrogen arsorite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium dihydrogen arsorite?
The IUPAC name of sodium dihydrogen arsorite (CID 23665008) is sodium dihydrogen arsorite.
What is the SMILES notation for sodium dihydrogen arsorite?
The canonical SMILES for sodium dihydrogen arsorite is [Na+].[O-][As](O)O.
What is the InChIKey of sodium dihydrogen arsorite?
The InChIKey is OMPOAAVAIXSVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/AsH2O3.Na/c2-1(3)4;/h2-3H;/q-1;+1.
What are the key properties of sodium dihydrogen arsorite?
sodium dihydrogen arsorite has a molecular weight of 147.93 g/mol, XLogP of -5.68, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium dihydrogen arsorite is sourced from PubChem (CID 23665008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).