About (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane
(3-diethylarsanylphenyl) N-methylcarbamate;iodomethane (PubChem CID 23621975) has the molecular formula C13H21AsINO2
and a molecular weight of 425.14 g/mol. Its IUPAC name is (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane.
Molecular Properties
| Compound Name | (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane |
| PubChem CID | 23621975 |
| Molecular Formula | C13H21AsINO2 |
| Molecular Weight | 425.14 g/mol |
| Exact Mass | 424.98 |
| IUPAC Name | (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane |
| SMILES | CC[As](CC)c1cccc(OC(=O)NC)c1.CI |
| InChI | InChI=1S/C12H18AsNO2.CH3I/c1-4-13(5-2)10-7-6-8-11(9-10)16-12(15)14-3;1-2/h6-9H,4-5H2,1-3H3,(H,14,15);1H3 |
| InChIKey | VROWRKBXALBFKX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.14 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane?
The IUPAC name of (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane (CID 23621975) is (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane.
What is the SMILES notation for (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane?
The canonical SMILES for (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane is CC[As](CC)c1cccc(OC(=O)NC)c1.CI.
What is the InChIKey of (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane?
The InChIKey is VROWRKBXALBFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18AsNO2.CH3I/c1-4-13(5-2)10-7-6-8-11(9-10)16-12(15)14-3;1-2/h6-9H,4-5H2,1-3H3,(H,14,15);1H3.
What are the key properties of (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane?
(3-diethylarsanylphenyl) N-methylcarbamate;iodomethane has a molecular weight of 425.14 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-diethylarsanylphenyl) N-methylcarbamate;iodomethane is sourced from PubChem (CID 23621975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).