C23H35NO10 — CID 23623269
N,N-diethyl-3-[2-(2-methyl-1,3-benzodioxol-2-yl)ethoxy]propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 23623269) has the molecular formula C23H35NO10 and a molecular weight of 485.53 g/mol. Its IUPAC name is N,N-diethyl-3-[2-(2-methyl-1,3-benzodioxol-2-yl)ethoxy]propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-diethyl-3-[2-(2-methyl-1,3-benzodioxol-2-yl)ethoxy]propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 23623269 |
| Molecular Formula | C23H35NO10 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N,N-diethyl-3-[2-(2-methyl-1,3-benzodioxol-2-yl)ethoxy]propan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCN(CC)CCCOCCC1(C)Oc2ccccc2O1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H27NO3.C6H8O7/c1-4-18(5-2)12-8-13-19-14-11-17(3)20-15-9-6-7-10-16(15)21-17;7-3(8)1-6(13,5(11)12)2-4(9)10/h6-7,9-10H,4-5,8,11-14H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | FLLJSESOLFLIBD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|