C16H14Br2N2 — CID 23628702
2-bromo-5-[(4-bromo-1H-pyrrol-2-yl)-(4-methylphenyl)methyl]-1H-pyrrole (PubChem CID 23628702) has the molecular formula C16H14Br2N2 and a molecular weight of 394.11 g/mol. Its IUPAC name is 2-bromo-5-[(4-bromo-1H-pyrrol-2-yl)-(4-methylphenyl)methyl]-1H-pyrrole.
| Compound Name | 2-bromo-5-[(4-bromo-1H-pyrrol-2-yl)-(4-methylphenyl)methyl]-1H-pyrrole |
|---|---|
| PubChem CID | 23628702 |
| Molecular Formula | C16H14Br2N2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.95 |
| IUPAC Name | 2-bromo-5-[(4-bromo-1H-pyrrol-2-yl)-(4-methylphenyl)methyl]-1H-pyrrole |
| SMILES | Cc1ccc(C(c2cc(Br)c[nH]2)c2ccc(Br)[nH]2)cc1 |
| InChI | InChI=1S/C16H14Br2N2/c1-10-2-4-11(5-3-10)16(13-6-7-15(18)20-13)14-8-12(17)9-19-14/h2-9,16,19-20H,1H3 |
| InChIKey | REVDSIHCOGCIQU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |