C13H27NO2SSi — CID 23630322
(2R)-4-oxo-2-(sulfanylmethyl)-N-(4-trimethylsilylbutyl)pentanamide (PubChem CID 23630322) has the molecular formula C13H27NO2SSi and a molecular weight of 289.52 g/mol. Its IUPAC name is (2R)-4-oxo-2-(sulfanylmethyl)-N-(4-trimethylsilylbutyl)pentanamide.
| Compound Name | (2R)-4-oxo-2-(sulfanylmethyl)-N-(4-trimethylsilylbutyl)pentanamide |
|---|---|
| PubChem CID | 23630322 |
| Molecular Formula | C13H27NO2SSi |
| Molecular Weight | 289.52 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (2R)-4-oxo-2-(sulfanylmethyl)-N-(4-trimethylsilylbutyl)pentanamide |
| SMILES | CC(=O)C[C@@H](CS)C(=O)NCCCC[Si](C)(C)C |
| InChI | InChI=1S/C13H27NO2SSi/c1-11(15)9-12(10-17)13(16)14-7-5-6-8-18(2,3)4/h12,17H,5-10H2,1-4H3,(H,14,16)/t12-/m0/s1 |
| InChIKey | PHJRATRQZDHNJR-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|