C16H17NO4S — CID 23631336
ethyl 3-(benzenesulfonyl)-3-cyano-4-methylidenecyclopentane-1-carboxylate (PubChem CID 23631336) has the molecular formula C16H17NO4S and a molecular weight of 319.38 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-3-cyano-4-methylidenecyclopentane-1-carboxylate.
| Compound Name | ethyl 3-(benzenesulfonyl)-3-cyano-4-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 23631336 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-3-cyano-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1CC(C(=O)OCC)CC1(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO4S/c1-3-21-15(18)13-9-12(2)16(10-13,11-17)22(19,20)14-7-5-4-6-8-14/h4-8,13H,2-3,9-10H2,1H3 |
| InChIKey | SALGBTAZBTXNRO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|