C25H32N4O14 — CID 23634934
[(2R,3R,4S,5S)-5-[3-acetyl-5-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4,5-tetraacetyloxypentyl] acetate (PubChem CID 23634934) has the molecular formula C25H32N4O14 and a molecular weight of 612.55 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-[3-acetyl-5-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4,5-tetraacetyloxypentyl] acetate.
| Compound Name | [(2R,3R,4S,5S)-5-[3-acetyl-5-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4,5-tetraacetyloxypentyl] acetate |
|---|---|
| PubChem CID | 23634934 |
| Molecular Formula | C25H32N4O14 |
| Molecular Weight | 612.55 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | [(2R,3R,4S,5S)-5-[3-acetyl-5-[(5-methyl-2,4-dioxopyrimidin-1-yl)methyl]-2H-1,3,4-oxadiazol-2-yl]-2,3,4,5-tetraacetyloxypentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C1OC(Cn2cc(C)c(=O)[nH]c2=O)=NN1C(C)=O |
| InChI | InChI=1S/C25H32N4O14/c1-11-8-28(25(37)26-23(11)36)9-19-27-29(12(2)30)24(43-19)22(42-17(7)35)21(41-16(6)34)20(40-15(5)33)18(39-14(4)32)10-38-13(3)31/h8,18,20-22,24H,9-10H2,1-7H3,(H,26,36,37)/t18-,20-,21+,22+,24?/m1/s1 |
| InChIKey | GZOXWSBPYJSKOS-NRZWNVTRSA-N |
| XLogP | -1.35 |
| TPSA | 228.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.55 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|