C23H42O2Si — CID 23643473
(E,3R)-5,5-dimethyl-1-[(1R,2R)-2-methyl-1-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]hept-1-en-6-yn-3-ol (PubChem CID 23643473) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (E,3R)-5,5-dimethyl-1-[(1R,2R)-2-methyl-1-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]hept-1-en-6-yn-3-ol.
| Compound Name | (E,3R)-5,5-dimethyl-1-[(1R,2R)-2-methyl-1-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]hept-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 23643473 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (E,3R)-5,5-dimethyl-1-[(1R,2R)-2-methyl-1-[tri(propan-2-yl)silyloxymethyl]cyclopropyl]hept-1-en-6-yn-3-ol |
| SMILES | C#CC(C)(C)C[C@@H](O)/C=C/[C@@]1(CO[Si](C(C)C)(C(C)C)C(C)C)C[C@H]1C |
| InChI | InChI=1S/C23H42O2Si/c1-11-22(9,10)15-21(24)12-13-23(14-20(23)8)16-25-26(17(2)3,18(4)5)19(6)7/h1,12-13,17-21,24H,14-16H2,2-10H3/b13-12+/t20-,21+,23+/m1/s1 |
| InChIKey | KLIBEJMGKJOPIR-FHTSGJMESA-N |
| XLogP | 6.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|