C22H38O2Si — CID 156686182
(1Z,4S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R)-2-ethynylcyclopropyl]-5,5-dimethylnona-1,7-dien-4-ol (PubChem CID 156686182) has the molecular formula C22H38O2Si and a molecular weight of 362.63 g/mol. Its IUPAC name is (1Z,4S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R)-2-ethynylcyclopropyl]-5,5-dimethylnona-1,7-dien-4-ol.
| Compound Name | (1Z,4S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R)-2-ethynylcyclopropyl]-5,5-dimethylnona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 156686182 |
| Molecular Formula | C22H38O2Si |
| Molecular Weight | 362.63 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (1Z,4S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-1-[(1R,2R)-2-ethynylcyclopropyl]-5,5-dimethylnona-1,7-dien-4-ol |
| SMILES | C#C[C@@H]1C[C@@H]1/C=C\C[C@H](O)C(C)(C)C(/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O2Si/c1-10-13-20(24-25(8,9)21(3,4)5)22(6,7)19(23)15-12-14-18-16-17(18)11-2/h2,10,12-14,17-20,23H,15-16H2,1,3-9H3/b13-10+,14-12-/t17-,18+,19+,20?/m1/s1 |
| InChIKey | OMSOUHFXDKYPGP-QTICJSOVSA-N |
| XLogP | 5.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|