C22H37BrO2Si — CID 156686200
(1Z,4S,7E)-1-[(1R,2R)-2-(2-bromoethynyl)cyclopropyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,7-dien-4-ol (PubChem CID 156686200) has the molecular formula C22H37BrO2Si and a molecular weight of 441.53 g/mol. Its IUPAC name is (1Z,4S,7E)-1-[(1R,2R)-2-(2-bromoethynyl)cyclopropyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,7-dien-4-ol.
| Compound Name | (1Z,4S,7E)-1-[(1R,2R)-2-(2-bromoethynyl)cyclopropyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 156686200 |
| Molecular Formula | C22H37BrO2Si |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (1Z,4S,7E)-1-[(1R,2R)-2-(2-bromoethynyl)cyclopropyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylnona-1,7-dien-4-ol |
| SMILES | C/C=C/C(O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H](O)C/C=C\[C@H]1C[C@H]1C#CBr |
| InChI | InChI=1S/C22H37BrO2Si/c1-9-11-20(25-26(7,8)21(2,3)4)22(5,6)19(24)13-10-12-17-16-18(17)14-15-23/h9-12,17-20,24H,13,16H2,1-8H3/b11-9+,12-10-/t17-,18+,19-,20?/m0/s1 |
| InChIKey | DBRMRIUGROXKOR-FNPQFPSSSA-N |
| XLogP | 6.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|