C23H42O2Si — CID 158753814
(1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2S)-2-[(E)-prop-1-enyl]cyclopropyl]nona-1,7-dien-4-ol (PubChem CID 158753814) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2S)-2-[(E)-prop-1-enyl]cyclopropyl]nona-1,7-dien-4-ol.
| Compound Name | (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2S)-2-[(E)-prop-1-enyl]cyclopropyl]nona-1,7-dien-4-ol |
|---|---|
| PubChem CID | 158753814 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | (1Z,4S,6S,7E)-6-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-1-[(1R,2S)-2-[(E)-prop-1-enyl]cyclopropyl]nona-1,7-dien-4-ol |
| SMILES | C/C=C/[C@@H]1C[C@@H]1/C=C\C[C@H](O)C(C)(C)[C@H](/C=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-10-13-18-17-19(18)15-12-16-20(24)23(6,7)21(14-11-2)25-26(8,9)22(3,4)5/h10-15,18-21,24H,16-17H2,1-9H3/b13-10+,14-11+,15-12-/t18-,19+,20+,21+/m1/s1 |
| InChIKey | INUSGXOBXATLSN-KHKRUFSTSA-N |
| XLogP | 6.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|