C26H30N4O3 — CID 23646282
cis-methyl (1R,2S)-2-[[2-(5-carbamimidoyl-1H-indol-3-yl)-3-phenylpropanoyl]amino]cyclohexane-1-carboxylate (PubChem CID 23646282) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is cis-methyl (1R,2S)-2-[[2-(5-carbamimidoyl-1H-indol-3-yl)-3-phenylpropanoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | cis-methyl (1R,2S)-2-[[2-(5-carbamimidoyl-1H-indol-3-yl)-3-phenylpropanoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23646282 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | cis-methyl (1R,2S)-2-[[2-(5-carbamimidoyl-1H-indol-3-yl)-3-phenylpropanoyl]amino]cyclohexane-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc2[nH]cc(C(Cc3ccccc3)C(=O)N[C@H]3CCCC[C@H]3C(=O)OC)c2c1 |
| InChI | InChI=1S/C26H30N4O3/c1-33-26(32)18-9-5-6-10-23(18)30-25(31)20(13-16-7-3-2-4-8-16)21-15-29-22-12-11-17(24(27)28)14-19(21)22/h2-4,7-8,11-12,14-15,18,20,23,29H,5-6,9-10,13H2,1H3,(H3,27,28)(H,30,31)/t18-,20?,23+/m1/s1 |
| InChIKey | QYQFYCXVJNUNSF-RAWUHTOPSA-N |
| XLogP | 3.63 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|