C35H49NO2Si — CID 23649560
tert-butyl-diphenyl-[2-[(2S,6R)-6-[(2S)-2-phenylmethoxypentyl]piperidin-2-yl]ethoxy]silane (PubChem CID 23649560) has the molecular formula C35H49NO2Si and a molecular weight of 543.87 g/mol. Its IUPAC name is tert-butyl-diphenyl-[2-[(2S,6R)-6-[(2S)-2-phenylmethoxypentyl]piperidin-2-yl]ethoxy]silane.
| Compound Name | tert-butyl-diphenyl-[2-[(2S,6R)-6-[(2S)-2-phenylmethoxypentyl]piperidin-2-yl]ethoxy]silane |
|---|---|
| PubChem CID | 23649560 |
| Molecular Formula | C35H49NO2Si |
| Molecular Weight | 543.87 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | tert-butyl-diphenyl-[2-[(2S,6R)-6-[(2S)-2-phenylmethoxypentyl]piperidin-2-yl]ethoxy]silane |
| SMILES | CCC[C@@H](C[C@H]1CCC[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1)OCc1ccccc1 |
| InChI | InChI=1S/C35H49NO2Si/c1-5-16-32(37-28-29-17-9-6-10-18-29)27-31-20-15-19-30(36-31)25-26-38-39(35(2,3)4,33-21-11-7-12-22-33)34-23-13-8-14-24-34/h6-14,17-18,21-24,30-32,36H,5,15-16,19-20,25-28H2,1-4H3/t30-,31+,32-/m0/s1 |
| InChIKey | KQOYHVNSDAGXQG-QAXCHELISA-N |
| XLogP | 7.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.87 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|