C32H31ClN4O5S — CID 23651124
1-[3-[[(1S,5S)-3-benzyl-3,8-diazabicyclo[3.2.1]octan-8-yl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-phenoxyphenyl)urea (PubChem CID 23651124) has the molecular formula C32H31ClN4O5S and a molecular weight of 619.14 g/mol. Its IUPAC name is 1-[3-[[(1S,5S)-3-benzyl-3,8-diazabicyclo[3.2.1]octan-8-yl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-phenoxyphenyl)urea.
| Compound Name | 1-[3-[[(1S,5S)-3-benzyl-3,8-diazabicyclo[3.2.1]octan-8-yl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 23651124 |
| Molecular Formula | C32H31ClN4O5S |
| Molecular Weight | 619.14 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | 1-[3-[[(1S,5S)-3-benzyl-3,8-diazabicyclo[3.2.1]octan-8-yl]sulfonyl]-4-chloro-2-hydroxyphenyl]-3-(2-phenoxyphenyl)urea |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)Nc1ccc(Cl)c(S(=O)(=O)N2[C@H]3CC[C@H]2CN(Cc2ccccc2)C3)c1O |
| InChI | InChI=1S/C32H31ClN4O5S/c33-26-17-18-28(35-32(39)34-27-13-7-8-14-29(27)42-25-11-5-2-6-12-25)30(38)31(26)43(40,41)37-23-15-16-24(37)21-36(20-23)19-22-9-3-1-4-10-22/h1-14,17-18,23-24,38H,15-16,19-21H2,(H2,34,35,39)/t23-,24-/m0/s1 |
| InChIKey | HIBBMGQVOXBVFH-ZEQRLZLVSA-N |
| XLogP | 6.52 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.14 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|