C22H24N2O3S — CID 23652354
5-[[4-[(1-ethyl-3,4-dihydro-2H-quinolin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 23652354) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 5-[[4-[(1-ethyl-3,4-dihydro-2H-quinolin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(1-ethyl-3,4-dihydro-2H-quinolin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 23652354 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 5-[[4-[(1-ethyl-3,4-dihydro-2H-quinolin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCN1c2ccccc2CCC1COc1ccc(CC2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-2-24-17(10-9-16-5-3-4-6-19(16)24)14-27-18-11-7-15(8-12-18)13-20-21(25)23-22(26)28-20/h3-8,11-12,17,20H,2,9-10,13-14H2,1H3,(H,23,25,26) |
| InChIKey | GIADYKWOBGOEIZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|