C24H26N2O4S — CID 139709213
5-[[4-[(4-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzoxazin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 139709213) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is 5-[[4-[(4-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzoxazin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(4-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzoxazin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 139709213 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 5-[[4-[(4-methyl-2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzoxazin-2-yl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CC(COc2ccc(CC3SC(=O)NC3=O)cc2)Oc2cc3c(cc21)CCCC3 |
| InChI | InChI=1S/C24H26N2O4S/c1-26-13-19(30-21-12-17-5-3-2-4-16(17)11-20(21)26)14-29-18-8-6-15(7-9-18)10-22-23(27)25-24(28)31-22/h6-9,11-12,19,22H,2-5,10,13-14H2,1H3,(H,25,27,28) |
| InChIKey | QJHXRWUBBNMQQE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|