C15H20O7 — CID 23655640
[(3aR,4R,5S,7aR)-4-acetyloxy-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]methyl acetate (PubChem CID 23655640) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is [(3aR,4R,5S,7aR)-4-acetyloxy-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]methyl acetate.
| Compound Name | [(3aR,4R,5S,7aR)-4-acetyloxy-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 23655640 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [(3aR,4R,5S,7aR)-4-acetyloxy-6-formyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C(C=O)=C[C@H]2OC(C)(C)O[C@H]2[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O7/c1-8(17)19-7-11-10(6-16)5-12-14(13(11)20-9(2)18)22-15(3,4)21-12/h5-6,11-14H,7H2,1-4H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | RWJASOILVSBWKR-AAVRWANBSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|