About methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate
methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate (PubChem CID 23656886) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate.
Analyze methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate?
The IUPAC name of methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate (CID 23656886) is methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate.
What is the SMILES notation for methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate?
The canonical SMILES for methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate is COC(=O)CCCC1=NC(C)CC1.
What is the InChIKey of methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate?
The InChIKey is FXEMDRYMBIUZGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-8-6-7-9(11-8)4-3-5-10(12)13-2/h8H,3-7H2,1-2H3.
What are the key properties of methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate?
methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate has a molecular weight of 183.25 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-methyl-3,4-dihydro-2H-pyrrol-5-yl)butanoate is sourced from PubChem (CID 23656886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).