C19H33N — CID 23657385
(1S,4R,9R,10S,13S)-5,5,9,13-tetramethyl-14-azatetracyclo[11.2.1.01,10.04,9]hexadecane (PubChem CID 23657385) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (1S,4R,9R,10S,13S)-5,5,9,13-tetramethyl-14-azatetracyclo[11.2.1.01,10.04,9]hexadecane.
| Compound Name | (1S,4R,9R,10S,13S)-5,5,9,13-tetramethyl-14-azatetracyclo[11.2.1.01,10.04,9]hexadecane |
|---|---|
| PubChem CID | 23657385 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (1S,4R,9R,10S,13S)-5,5,9,13-tetramethyl-14-azatetracyclo[11.2.1.01,10.04,9]hexadecane |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H]1CC[C@@]13CN[C@@](C)(CC[C@H]12)C3 |
| InChI | InChI=1S/C19H33N/c1-16(2)8-5-9-18(4)14(16)7-11-19-12-17(3,20-13-19)10-6-15(18)19/h14-15,20H,5-13H2,1-4H3/t14-,15+,17+,18-,19-/m1/s1 |
| InChIKey | HSSCQGLDQWBVCM-UWAKZDDMSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |