C13H18NNaO9S2 — CID 23670992
sodium [2-(acetyloxymethyl)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]propyl] sulfate (PubChem CID 23670992) has the molecular formula C13H18NNaO9S2 and a molecular weight of 419.41 g/mol. Its IUPAC name is sodium [2-(acetyloxymethyl)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]propyl] sulfate.
| Compound Name | sodium [2-(acetyloxymethyl)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]propyl] sulfate |
|---|---|
| PubChem CID | 23670992 |
| Molecular Formula | C13H18NNaO9S2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | sodium [2-(acetyloxymethyl)-2-hydroxy-3-[(4-methylphenyl)sulfonylamino]propyl] sulfate |
| SMILES | CC(=O)OCC(O)(CNS(=O)(=O)c1ccc(C)cc1)COS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H19NO9S2.Na/c1-10-3-5-12(6-4-10)24(17,18)14-7-13(16,8-22-11(2)15)9-23-25(19,20)21;/h3-6,14,16H,7-9H2,1-2H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | ULYOYQHUQZMEPL-UHFFFAOYSA-M |
| XLogP | -3.95 |
| TPSA | 159.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|