C20H25NO7S2 — CID 6431702
[2-methyl-2-[(4-methylphenyl)sulfonylamino]-3-(4-methylphenyl)sulfonyloxypropyl] acetate (PubChem CID 6431702) has the molecular formula C20H25NO7S2 and a molecular weight of 455.55 g/mol. Its IUPAC name is [2-methyl-2-[(4-methylphenyl)sulfonylamino]-3-(4-methylphenyl)sulfonyloxypropyl] acetate.
| Compound Name | [2-methyl-2-[(4-methylphenyl)sulfonylamino]-3-(4-methylphenyl)sulfonyloxypropyl] acetate |
|---|---|
| PubChem CID | 6431702 |
| Molecular Formula | C20H25NO7S2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [2-methyl-2-[(4-methylphenyl)sulfonylamino]-3-(4-methylphenyl)sulfonyloxypropyl] acetate |
| SMILES | CC(=O)OCC(C)(COS(=O)(=O)c1ccc(C)cc1)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25NO7S2/c1-15-5-9-18(10-6-15)29(23,24)21-20(4,13-27-17(3)22)14-28-30(25,26)19-11-7-16(2)8-12-19/h5-12,21H,13-14H2,1-4H3 |
| InChIKey | IFERCIXUYCPJIU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|