About sodium triphenylmethanethiolate
sodium triphenylmethanethiolate (PubChem CID 23672905) has the molecular formula C19H15NaS
and a molecular weight of 298.39 g/mol. Its IUPAC name is sodium triphenylmethanethiolate.
Molecular Properties
| Compound Name | sodium triphenylmethanethiolate |
| PubChem CID | 23672905 |
| Molecular Formula | C19H15NaS |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | sodium triphenylmethanethiolate |
| SMILES | [Na+].[S-]C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16S.Na/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15,20H;/q;+1/p-1 |
| InChIKey | IGFISYKOFXTZRP-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze sodium triphenylmethanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium triphenylmethanethiolate?
The IUPAC name of sodium triphenylmethanethiolate (CID 23672905) is sodium triphenylmethanethiolate.
What is the SMILES notation for sodium triphenylmethanethiolate?
The canonical SMILES for sodium triphenylmethanethiolate is [Na+].[S-]C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of sodium triphenylmethanethiolate?
The InChIKey is IGFISYKOFXTZRP-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H16S.Na/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15,20H;/q;+1/p-1.
What are the key properties of sodium triphenylmethanethiolate?
sodium triphenylmethanethiolate has a molecular weight of 298.39 g/mol, XLogP of 1.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium triphenylmethanethiolate is sourced from PubChem (CID 23672905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).