C18H18N3NaO7S — CID 23678453
sodium (7S)-5-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-2-oxo-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),4,10,12(16)-tetraene-8-sulfonate (PubChem CID 23678453) has the molecular formula C18H18N3NaO7S and a molecular weight of 443.41 g/mol. Its IUPAC name is sodium (7S)-5-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-2-oxo-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),4,10,12(16)-tetraene-8-sulfonate.
| Compound Name | sodium (7S)-5-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-2-oxo-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),4,10,12(16)-tetraene-8-sulfonate |
|---|---|
| PubChem CID | 23678453 |
| Molecular Formula | C18H18N3NaO7S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | sodium (7S)-5-[(E)-3-(dimethylamino)-3-oxoprop-1-enyl]-2-oxo-13,15-dioxa-3,9-diazatetracyclo[8.7.0.03,7.012,16]heptadeca-1(17),4,10,12(16)-tetraene-8-sulfonate |
| SMILES | CN(C)C(=O)/C=C/C1=CN2C(=O)c3cc4c(cc3NC(S(=O)(=O)[O-])[C@@H]2C1)OCO4.[Na+] |
| InChI | InChI=1S/C18H19N3O7S.Na/c1-20(2)16(22)4-3-10-5-13-17(29(24,25)26)19-12-7-15-14(27-9-28-15)6-11(12)18(23)21(13)8-10;/h3-4,6-8,13,17,19H,5,9H2,1-2H3,(H,24,25,26);/q;+1/p-1/b4-3+;/t13-,17?;/m0./s1 |
| InChIKey | QJQRNDGUWQVAEV-AAFSJPGBSA-M |
| XLogP | -2.54 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|