C11H7NO5 — CID 19608274
2,4,12,14-tetraoxa-7-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one (PubChem CID 19608274) has the molecular formula C11H7NO5 and a molecular weight of 233.18 g/mol. Its IUPAC name is 2,4,12,14-tetraoxa-7-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one.
| Compound Name | 2,4,12,14-tetraoxa-7-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one |
|---|---|
| PubChem CID | 19608274 |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2,4,12,14-tetraoxa-7-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one |
| SMILES | O=C1c2cc3c(cc2OC2OC=CN12)OCO3 |
| InChI | InChI=1S/C11H7NO5/c13-10-6-3-8-9(16-5-15-8)4-7(6)17-11-12(10)1-2-14-11/h1-4,11H,5H2 |
| InChIKey | UZOWWWGTPXDAAB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |