C11H11Cl2NaO3 — CID 23688261
sodium 5-(3,4-dichlorophenyl)-4-hydroxypentanoate (PubChem CID 23688261) has the molecular formula C11H11Cl2NaO3 and a molecular weight of 285.10 g/mol. Its IUPAC name is sodium 5-(3,4-dichlorophenyl)-4-hydroxypentanoate.
| Compound Name | sodium 5-(3,4-dichlorophenyl)-4-hydroxypentanoate |
|---|---|
| PubChem CID | 23688261 |
| Molecular Formula | C11H11Cl2NaO3 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | sodium 5-(3,4-dichlorophenyl)-4-hydroxypentanoate |
| SMILES | O=C([O-])CCC(O)Cc1ccc(Cl)c(Cl)c1.[Na+] |
| InChI | InChI=1S/C11H12Cl2O3.Na/c12-9-3-1-7(6-10(9)13)5-8(14)2-4-11(15)16;/h1,3,6,8,14H,2,4-5H2,(H,15,16);/q;+1/p-1 |
| InChIKey | AKYNBIHALIYJOL-UHFFFAOYSA-M |
| XLogP | -1.57 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |