C14H16ClKN2O5S — CID 23698151
potassium [(Z)-[7-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-ylidene]amino] sulfate (PubChem CID 23698151) has the molecular formula C14H16ClKN2O5S and a molecular weight of 398.91 g/mol. Its IUPAC name is potassium [(Z)-[7-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-ylidene]amino] sulfate.
| Compound Name | potassium [(Z)-[7-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-ylidene]amino] sulfate |
|---|---|
| PubChem CID | 23698151 |
| Molecular Formula | C14H16ClKN2O5S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | potassium [(Z)-[7-chloro-1-(2,2-dimethylpropanoyl)-2,3-dihydroquinolin-4-ylidene]amino] sulfate |
| SMILES | CC(C)(C)C(=O)N1CC/C(=N/OS(=O)(=O)[O-])c2ccc(Cl)cc21.[K+] |
| InChI | InChI=1S/C14H17ClN2O5S.K/c1-14(2,3)13(18)17-7-6-11(16-22-23(19,20)21)10-5-4-9(15)8-12(10)17;/h4-5,8H,6-7H2,1-3H3,(H,19,20,21);/q;+1/p-1/b16-11-; |
| InChIKey | CTHXVRFWCPJQOD-MWVRIADDSA-M |
| XLogP | -0.69 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|