C11H9F3N2O2S — CID 23724850
4-amino-3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-thiazole-5-carboxylic acid (PubChem CID 23724850) has the molecular formula C11H9F3N2O2S and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-amino-3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-thiazole-5-carboxylic acid.
| Compound Name | 4-amino-3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 23724850 |
| Molecular Formula | C11H9F3N2O2S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 4-amino-3-[3-(trifluoromethyl)phenyl]-4,5-dihydro-1,2-thiazole-5-carboxylic acid |
| SMILES | NC1C(c2cccc(C(F)(F)F)c2)=NSC1C(=O)O |
| InChI | InChI=1S/C11H9F3N2O2S/c12-11(13,14)6-3-1-2-5(4-6)8-7(15)9(10(17)18)19-16-8/h1-4,7,9H,15H2,(H,17,18) |
| InChIKey | UHUZWGKEMHCDAI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|