C24H35N7O5 — CID 23725110
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide (PubChem CID 23725110) has the molecular formula C24H35N7O5 and a molecular weight of 501.59 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 23725110 |
| Molecular Formula | C24H35N7O5 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cccc1C.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22N2O.C10H13N5O4/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h7-9H,5-6,10H2,1-4H3,(H,15,17);2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t;4-,6-,7-,10-/m.1/s1 |
| InChIKey | BKHAXEVUNFEBHD-LPEHXXKESA-N |
| XLogP | 0.60 |
| TPSA | 171.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |