C19H24O8S — CID 23727251
(1S,2S,4R,5S)-2-methoxy-4-[[(1R,3S,4R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 23727251) has the molecular formula C19H24O8S and a molecular weight of 412.46 g/mol. Its IUPAC name is (1S,2S,4R,5S)-2-methoxy-4-[[(1R,3S,4R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2S,4R,5S)-2-methoxy-4-[[(1R,3S,4R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 23727251 |
| Molecular Formula | C19H24O8S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (1S,2S,4R,5S)-2-methoxy-4-[[(1R,3S,4R,5R)-3-methoxy-5-(4-methylphenyl)sulfonyl-2-oxabicyclo[3.1.0]hexan-4-yl]oxymethyl]-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | CO[C@H]1O[C@H](CO[C@@H]2[C@@H](OC)O[C@@H]3C[C@]23S(=O)(=O)c2ccc(C)cc2)[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C19H24O8S/c1-10-4-6-11(7-5-10)28(20,21)19-8-13(19)26-18(23-3)16(19)24-9-12-14-15(27-14)17(22-2)25-12/h4-7,12-18H,8-9H2,1-3H3/t12-,13-,14+,15+,16-,17+,18+,19-/m1/s1 |
| InChIKey | LDYSDMXZDOSEJZ-RVQKZODYSA-N |
| XLogP | 0.81 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|