C19H17Cl2F3N6O — CID 23729713
N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[[6-(trifluoromethyl)-3-pyridinyl]amino]methylidene]amino]propyl]-3-methylbenzamide (PubChem CID 23729713) has the molecular formula C19H17Cl2F3N6O and a molecular weight of 473.29 g/mol. Its IUPAC name is N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[[6-(trifluoromethyl)-3-pyridinyl]amino]methylidene]amino]propyl]-3-methylbenzamide.
| Compound Name | N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[[6-(trifluoromethyl)-3-pyridinyl]amino]methylidene]amino]propyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 23729713 |
| Molecular Formula | C19H17Cl2F3N6O |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[[6-(trifluoromethyl)-3-pyridinyl]amino]methylidene]amino]propyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(/N=C(\NC#N)Nc2ccc(C(F)(F)F)nc2)C(C)(Cl)Cl)c1 |
| InChI | InChI=1S/C19H17Cl2F3N6O/c1-11-4-3-5-12(8-11)15(31)29-16(18(2,20)21)30-17(27-10-25)28-13-6-7-14(26-9-13)19(22,23)24/h3-9,16H,1-2H3,(H,29,31)(H2,27,28,30) |
| InChIKey | REVUUXVVHSKXSP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|