C19H19I2NO3 — CID 23729911
[2-[(4-tert-butylphenyl)carbamoyl]-4,6-diiodophenyl] acetate (PubChem CID 23729911) has the molecular formula C19H19I2NO3 and a molecular weight of 563.17 g/mol. Its IUPAC name is [2-[(4-tert-butylphenyl)carbamoyl]-4,6-diiodophenyl] acetate.
| Compound Name | [2-[(4-tert-butylphenyl)carbamoyl]-4,6-diiodophenyl] acetate |
|---|---|
| PubChem CID | 23729911 |
| Molecular Formula | C19H19I2NO3 |
| Molecular Weight | 563.17 g/mol |
| Exact Mass | 562.95 |
| IUPAC Name | [2-[(4-tert-butylphenyl)carbamoyl]-4,6-diiodophenyl] acetate |
| SMILES | CC(=O)Oc1c(I)cc(I)cc1C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H19I2NO3/c1-11(23)25-17-15(9-13(20)10-16(17)21)18(24)22-14-7-5-12(6-8-14)19(2,3)4/h5-10H,1-4H3,(H,22,24) |
| InChIKey | VXTQHWHTNFYQSW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.17 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|