C15H19NO3Se — CID 23730293
(5R,7S,8S,8aR)-5-ethyl-8-hydroxy-7-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 23730293) has the molecular formula C15H19NO3Se and a molecular weight of 340.28 g/mol. Its IUPAC name is (5R,7S,8S,8aR)-5-ethyl-8-hydroxy-7-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5R,7S,8S,8aR)-5-ethyl-8-hydroxy-7-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 23730293 |
| Molecular Formula | C15H19NO3Se |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (5R,7S,8S,8aR)-5-ethyl-8-hydroxy-7-phenylselanyl-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | CC[C@@H]1C[C@H]([Se]c2ccccc2)[C@@H](O)[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C15H19NO3Se/c1-2-10-8-13(20-11-6-4-3-5-7-11)14(17)12-9-19-15(18)16(10)12/h3-7,10,12-14,17H,2,8-9H2,1H3/t10-,12-,13+,14+/m1/s1 |
| InChIKey | HXLKFOVEJPZXAG-ZZVYKPCYSA-N |
| XLogP | 1.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|