C18H20N2O4 — CID 23735092
ethyl 5-(3-cyano-2-oxopropoxy)-1-ethyl-2-methylindole-3-carboxylate (PubChem CID 23735092) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 5-(3-cyano-2-oxopropoxy)-1-ethyl-2-methylindole-3-carboxylate.
| Compound Name | ethyl 5-(3-cyano-2-oxopropoxy)-1-ethyl-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 23735092 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | ethyl 5-(3-cyano-2-oxopropoxy)-1-ethyl-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(CC)c2ccc(OCC(=O)CC#N)cc12 |
| InChI | InChI=1S/C18H20N2O4/c1-4-20-12(3)17(18(22)23-5-2)15-10-14(6-7-16(15)20)24-11-13(21)8-9-19/h6-7,10H,4-5,8,11H2,1-3H3 |
| InChIKey | IPVGANMPNYABRK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |