C25H27NO3 — CID 23737658
2-[(2,5-dimethoxyanilino)-naphthalen-2-ylmethyl]cyclohexan-1-one (PubChem CID 23737658) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyanilino)-naphthalen-2-ylmethyl]cyclohexan-1-one.
| Compound Name | 2-[(2,5-dimethoxyanilino)-naphthalen-2-ylmethyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 23737658 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[(2,5-dimethoxyanilino)-naphthalen-2-ylmethyl]cyclohexan-1-one |
| SMILES | COc1ccc(OC)c(NC(c2ccc3ccccc3c2)C2CCCCC2=O)c1 |
| InChI | InChI=1S/C25H27NO3/c1-28-20-13-14-24(29-2)22(16-20)26-25(21-9-5-6-10-23(21)27)19-12-11-17-7-3-4-8-18(17)15-19/h3-4,7-8,11-16,21,25-26H,5-6,9-10H2,1-2H3 |
| InChIKey | IBENDVKSQHSRHG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |