C14H9NO5 — CID 23740281
methyl 2,5-dioxo-5,10-dihydro-2H-pyrano[2,3-b]quinoline-3-carboxylate (PubChem CID 23740281) has the molecular formula C14H9NO5 and a molecular weight of 271.22 g/mol. Its IUPAC name is methyl 2,5-dioxo-10H-pyrano[2,3-b]quinoline-3-carboxylate.
| Compound Name | methyl 2,5-dioxo-5,10-dihydro-2H-pyrano[2,3-b]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 23740281 |
| Molecular Formula | C14H9NO5 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | methyl 2,5-dioxo-10H-pyrano[2,3-b]quinoline-3-carboxylate |
| SMILES | COC(=O)C1=CC2=C(NC3=CC=CC=C3C2=O)OC1=O |
| InChI | InChI=1S/C14H9NO5/c1-19-13(17)9-6-8-11(16)7-4-2-3-5-10(7)15-12(8)20-14(9)18/h2-6H,1H3,(H,15,16) |
| InChIKey | RZSZPCGKVUYSJU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 560 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|