C51H48N2O6 — CID 23748042
1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-[(4-phenylphenyl)methyl]amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate (PubChem CID 23748042) has the molecular formula C51H48N2O6 and a molecular weight of 784.95 g/mol. Its IUPAC name is 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-[(4-phenylphenyl)methyl]amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate.
| Compound Name | 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-[(4-phenylphenyl)methyl]amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
|---|---|
| PubChem CID | 23748042 |
| Molecular Formula | C51H48N2O6 |
| Molecular Weight | 784.95 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-[(4-phenylphenyl)methyl]amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
| SMILES | C=CCC(OC(C)=O)[C@@H]1[C@@H](N(Cc2ccc(-c3ccccc3)cc2)C(=O)c2ccc(C)cc2)c2cc(OCCCO)ccc2N1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C51H48N2O6/c1-4-12-47(59-36(3)55)49-48(52(50(56)42-21-17-35(2)18-22-42)34-37-19-23-40(24-20-37)38-13-7-5-8-14-38)45-33-44(58-32-11-31-54)29-30-46(45)53(49)51(57)43-27-25-41(26-28-43)39-15-9-6-10-16-39/h4-10,13-30,33,47-49,54H,1,11-12,31-32,34H2,2-3H3/t47?,48-,49+/m0/s1 |
| InChIKey | LYCLUNBSHGBFAZ-YAUTWHJVSA-N |
| XLogP | 10.01 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.95 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|