C49H46N2O6 — CID 23777156
1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate (PubChem CID 23777156) has the molecular formula C49H46N2O6 and a molecular weight of 758.92 g/mol. Its IUPAC name is 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate.
| Compound Name | 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
|---|---|
| PubChem CID | 23777156 |
| Molecular Formula | C49H46N2O6 |
| Molecular Weight | 758.92 g/mol |
| Exact Mass | 758.34 |
| IUPAC Name | 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[(4-methylbenzoyl)-(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
| SMILES | C=CCC(OC(C)=O)[C@@H]1[C@@H](N(Cc2cccc3ccccc23)C(=O)c2ccc(C)cc2)c2cc(OCCCO)ccc2N1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C49H46N2O6/c1-4-12-45(57-34(3)53)47-46(50(48(54)38-21-19-33(2)20-22-38)32-40-17-10-16-37-15-8-9-18-42(37)40)43-31-41(56-30-11-29-52)27-28-44(43)51(47)49(55)39-25-23-36(24-26-39)35-13-6-5-7-14-35/h4-10,13-28,31,45-47,52H,1,11-12,29-30,32H2,2-3H3/t45?,46-,47+/m0/s1 |
| InChIKey | HTGCWGIMENTBRO-MKISUTETSA-N |
| XLogP | 9.50 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.92 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|