C47H43FN2O7 — CID 23863277
1-[(2S,3S)-3-[1-benzofuran-2-ylmethyl-[2-(4-fluorophenyl)acetyl]amino]-5-(3-hydroxypropoxy)-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate (PubChem CID 23863277) has the molecular formula C47H43FN2O7 and a molecular weight of 766.87 g/mol. Its IUPAC name is 1-[(2S,3S)-3-[1-benzofuran-2-ylmethyl-[2-(4-fluorophenyl)acetyl]amino]-5-(3-hydroxypropoxy)-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate.
| Compound Name | 1-[(2S,3S)-3-[1-benzofuran-2-ylmethyl-[2-(4-fluorophenyl)acetyl]amino]-5-(3-hydroxypropoxy)-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
|---|---|
| PubChem CID | 23863277 |
| Molecular Formula | C47H43FN2O7 |
| Molecular Weight | 766.87 g/mol |
| Exact Mass | 766.31 |
| IUPAC Name | 1-[(2S,3S)-3-[1-benzofuran-2-ylmethyl-[2-(4-fluorophenyl)acetyl]amino]-5-(3-hydroxypropoxy)-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
| SMILES | C=CCC(OC(C)=O)[C@@H]1[C@@H](N(Cc2cc3ccccc3o2)C(=O)Cc2ccc(F)cc2)c2cc(OCCCO)ccc2N1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C47H43FN2O7/c1-3-10-43(56-31(2)52)46-45(49(44(53)27-32-15-21-37(48)22-16-32)30-39-28-36-13-7-8-14-42(36)57-39)40-29-38(55-26-9-25-51)23-24-41(40)50(46)47(54)35-19-17-34(18-20-35)33-11-5-4-6-12-33/h3-8,11-24,28-29,43,45-46,51H,1,9-10,25-27,30H2,2H3/t43?,45-,46+/m0/s1 |
| InChIKey | PTHBTTUSJLCVQV-WFMIUPDNSA-N |
| XLogP | 8.85 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.87 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|