C52H46N2O6 — CID 23975634
1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[naphthalene-1-carbonyl(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate (PubChem CID 23975634) has the molecular formula C52H46N2O6 and a molecular weight of 794.95 g/mol. Its IUPAC name is 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[naphthalene-1-carbonyl(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate.
| Compound Name | 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[naphthalene-1-carbonyl(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
|---|---|
| PubChem CID | 23975634 |
| Molecular Formula | C52H46N2O6 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 1-[(2S,3S)-5-(3-hydroxypropoxy)-3-[naphthalene-1-carbonyl(naphthalen-1-ylmethyl)amino]-1-(4-phenylbenzoyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
| SMILES | C=CCC(OC(C)=O)[C@@H]1[C@@H](N(Cc2cccc3ccccc23)C(=O)c2cccc3ccccc23)c2cc(OCCCO)ccc2N1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C52H46N2O6/c1-3-14-48(60-35(2)56)50-49(53(34-41-21-11-19-38-17-7-9-22-43(38)41)52(58)45-24-12-20-39-18-8-10-23-44(39)45)46-33-42(59-32-13-31-55)29-30-47(46)54(50)51(57)40-27-25-37(26-28-40)36-15-5-4-6-16-36/h3-12,15-30,33,48-50,55H,1,13-14,31-32,34H2,2H3/t48?,49-,50+/m0/s1 |
| InChIKey | MQVYWILPXFVDJN-ODNCIIBSSA-N |
| XLogP | 10.34 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|