C50H47FN2O6 — CID 23777153
1-[(2S,3S)-3-[[2-(4-fluorophenyl)acetyl]-[(4-phenylphenyl)methyl]amino]-5-(3-hydroxypropoxy)-1-(2-naphthalen-2-ylacetyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate (PubChem CID 23777153) has the molecular formula C50H47FN2O6 and a molecular weight of 790.93 g/mol. Its IUPAC name is 1-[(2S,3S)-3-[[2-(4-fluorophenyl)acetyl]-[(4-phenylphenyl)methyl]amino]-5-(3-hydroxypropoxy)-1-(2-naphthalen-2-ylacetyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate.
| Compound Name | 1-[(2S,3S)-3-[[2-(4-fluorophenyl)acetyl]-[(4-phenylphenyl)methyl]amino]-5-(3-hydroxypropoxy)-1-(2-naphthalen-2-ylacetyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
|---|---|
| PubChem CID | 23777153 |
| Molecular Formula | C50H47FN2O6 |
| Molecular Weight | 790.93 g/mol |
| Exact Mass | 790.34 |
| IUPAC Name | 1-[(2S,3S)-3-[[2-(4-fluorophenyl)acetyl]-[(4-phenylphenyl)methyl]amino]-5-(3-hydroxypropoxy)-1-(2-naphthalen-2-ylacetyl)-2,3-dihydroindol-2-yl]but-3-enyl acetate |
| SMILES | C=CCC(OC(C)=O)[C@@H]1[C@@H](N(Cc2ccc(-c3ccccc3)cc2)C(=O)Cc2ccc(F)cc2)c2cc(OCCCO)ccc2N1C(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C50H47FN2O6/c1-3-10-46(59-34(2)55)50-49(52(47(56)30-35-18-23-42(51)24-19-35)33-36-15-20-40(21-16-36)38-11-5-4-6-12-38)44-32-43(58-28-9-27-54)25-26-45(44)53(50)48(57)31-37-17-22-39-13-7-8-14-41(39)29-37/h3-8,11-26,29,32,46,49-50,54H,1,9-10,27-28,30-31,33H2,2H3/t46?,49-,50+/m0/s1 |
| InChIKey | JLIWULPMVSIUOI-ARVQUXJBSA-N |
| XLogP | 9.19 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.93 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|