C18H24O6 — CID 23748763
[(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-oxohex-5-enyl] acetate (PubChem CID 23748763) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-oxohex-5-enyl] acetate.
| Compound Name | [(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-oxohex-5-enyl] acetate |
|---|---|
| PubChem CID | 23748763 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(1S)-1-[3-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-oxohex-5-enyl] acetate |
| SMILES | C=C(COC)C(=O)CC[C@H](OC(C)=O)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C18H24O6/c1-13(12-22-3)17(21)7-8-18(24-14(2)20)15-5-4-6-16(11-15)23-10-9-19/h4-6,11,18-19H,1,7-10,12H2,2-3H3/t18-/m0/s1 |
| InChIKey | UYPRISJMQWSAMC-SFHVURJKSA-N |
| XLogP | 2.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|